CAS 16944-60-8 appears in our catalog under these names: (S)–3–Isopropyl–2,5–piperazinedione, (S)-3-Isopropyl-2,5-piperazinedione, 98%, 98%, (S)-3-Isopropyl-2,5-piperizinedione, 95%, (S)-3-Isopropylpiperazine-2,5-dione, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
(3S)-3-propan-2-ylpiperazine-2,5-dione (CAS 16944-60-8) is a chemical compound with the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. IUPAC name: (3S)-3-propan-2-ylpiperazine-2,5-dione. InChIKey: IULFBTHVPRNQCG-LURJTMIESA-N.
| Molecular formula | C7H12N2O2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (3S)-3-propan-2-ylpiperazine-2,5-dione |
| InChIKey | IULFBTHVPRNQCG-LURJTMIESA-N |
| SMILES | CC(C)[C@H]1C(=O)NCC(=O)N1 |
Computed by PubChem (NCBI)