CAS 143673-66-9 appears in our catalog under these names: (R)-3-Isopropyl-2,5-piperazinedione, 95%, (R)–(–)–3–Isopropyl–2,5–piperazinedione, (R)-3-Isopropylpiperazine-2,5-dione 97%, (R)-3-Isopropylpiperazine-2,5-dione, 98%, 98%, (R)-3-Isopropyl-2,5-piperizinedione, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 250mg, 100mg.
(3R)-3-propan-2-ylpiperazine-2,5-dione (CAS 143673-66-9) is a chemical compound with the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. IUPAC name: (3R)-3-propan-2-ylpiperazine-2,5-dione. InChIKey: IULFBTHVPRNQCG-ZCFIWIBFSA-N.
| Molecular formula | C7H12N2O2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (3R)-3-propan-2-ylpiperazine-2,5-dione |
| InChIKey | IULFBTHVPRNQCG-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@@H]1C(=O)NCC(=O)N1 |
Computed by PubChem (NCBI)