cas: 1217858-20-2 — see every product listed under this CAS number, including other names
(R)-3-N-Boc-Aminomethyl pyrrolidine hydrochloride, 95% (CAS 1217858-20-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048445-250MG |
| cas | 1217858-20-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1299.56 Pln | |
| Fluorochem | 10g | 2403.34 Pln | |
| Fluorochem | 25g | 5277.33 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[[(3R)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride (CAS 1217858-20-2) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[[(3R)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride. InChIKey: WEUDEPABMRKFFT-DDWIOCJRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[[(3R)-pyrrolidin-3-yl]methyl]carbamate;hydrochloride |
| InChIKey | WEUDEPABMRKFFT-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCNC1.Cl |
Computed by PubChem (NCBI)