CAS 1353006-46-8 appears in our catalog under these names: Tert-butyl (3S)-3-methylpiperazine-1-carboxylate hydrochloride, 98%, (S)-1-Boc-3-Methylpiperazine hydrochloride, 95%, 95%, (S)-1-Boc-3-Methylpiperazine hydrochloride, 98%, (S)-1-Boc-3-Methylpiperazine hydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
Tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride (CAS 1353006-46-8) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: SYNMIMWDYFYCCC-QRPNPIFTSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (3S)-3-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | SYNMIMWDYFYCCC-QRPNPIFTSA-N |
| SMILES | C[C@H]1CN(CCN1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)