cas: 131690-57-8 — see every product listed under this CAS number, including other names
(R)-3-amino-3-(4-methoxyphenyl)propanoic acid, 97%, 97% (CAS 131690-57-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ZKR-5g |
| cas | 131690-57-8 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2190.80 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 491.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-amino-3-(4-methoxyphenyl)propanoic acid (CAS 131690-57-8) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (3R)-3-amino-3-(4-methoxyphenyl)propanoic acid. InChIKey: NYTANCDDCQVQHG-SECBINFHSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | NYTANCDDCQVQHG-SECBINFHSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)