CAS 131690-56-7 appears in our catalog under these names: (S)-3-Amino-3-(4-methoxy-phenyl)-propionic acid, 96%, (S)–3–Amino–3–(4–methoxyphenyl)propanoic acid, H-β-Phe(4-OMe)-OH 97%, (S)-3-Amino-3-(4-methoxyphenyl)propanoic acid, (S)-beta-(p-Methoxyphenyl)alanine, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
(3S)-3-amino-3-(4-methoxyphenyl)propanoic acid (CAS 131690-56-7) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (3S)-3-amino-3-(4-methoxyphenyl)propanoic acid. InChIKey: NYTANCDDCQVQHG-VIFPVBQESA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | NYTANCDDCQVQHG-VIFPVBQESA-N |
| SMILES | COC1=CC=C(C=C1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)