cas: 1212074-78-6 — see every product listed under this CAS number, including other names
(R)-4-(2-CARBOXY-PYRROLIDIN-1-YL)-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER, 98% (CAS 1212074-78-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F857226-1G |
| cas | 1212074-78-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3137.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrrolidine-2-carboxylic acid (CAS 1212074-78-6) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: (2R)-1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrrolidine-2-carboxylic acid. InChIKey: LEJHMMZZSDZTLY-GFCCVEGCSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | (2R)-1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrrolidine-2-carboxylic acid |
| InChIKey | LEJHMMZZSDZTLY-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2CCC[C@@H]2C(=O)O |
Computed by PubChem (NCBI)