CAS 1357354-49-4 appears in our catalog under these names: 2–tert–Butyl 9–ethyl 2,7–diazaspiro(4·4)nonane–2,9–dicarboxylate, 2-tert-Butyl 9-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate, 95%, 2-tert-Butyl 9-ethyl 2,7-diazaspiro(4.4)nonane-2,9-dicarboxylate, 97%, 9-Ethyl-(2-boc)-2,7-diazaspiro(4.4)nonane-9-carboxylate, 2-tert-butyl 9-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate, 96%, 96%. Offered by: GLPBio, Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 500mg.
2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate (CAS 1357354-49-4) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate. InChIKey: LKKYIMUKDUHHII-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | 2-O-tert-butyl 9-O-ethyl 2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate |
| InChIKey | LKKYIMUKDUHHII-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNCC12CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)