Products 2102410-34-2

CAS 2102410-34-2 appears in our catalog under these names: 2-tert-Butyl 5-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate, 95%, 2-(tert-Butyl) 5-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate 95%, 2-(Tert-butyl) 5-ethyl 2,7-diazaspiro[3.5]Nonane-2,5-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate (CAS 2102410-34-2) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate. InChIKey: WVVJCSWSUQMJTO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O4
Molecular weight298.38 g/mol
IUPAC name2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate
InChIKeyWVVJCSWSUQMJTO-UHFFFAOYSA-N
SMILESCCOC(=O)C1CNCCC12CN(C2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)