CAS 2102410-34-2 appears in our catalog under these names: 2-tert-Butyl 5-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate, 95%, 2-(tert-Butyl) 5-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate 95%, 2-(Tert-butyl) 5-ethyl 2,7-diazaspiro[3.5]Nonane-2,5-dicarboxylate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate (CAS 2102410-34-2) is a chemical compound with the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. IUPAC name: 2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate. InChIKey: WVVJCSWSUQMJTO-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O4 |
|---|---|
| Molecular weight | 298.38 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-ethyl 2,7-diazaspiro[3.5]nonane-2,5-dicarboxylate |
| InChIKey | WVVJCSWSUQMJTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNCCC12CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)