cas: 501-96-2 — see every product listed under this CAS number, including other names
(R)-4-(3-Hydroxybutyl)phenol, 98%, 98% (CAS 501-96-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DFJ8-25mg |
| cas | 501-96-2 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 237.20 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 1302.80 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[(3R)-3-hydroxybutyl]phenol (CAS 501-96-2) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 4-[(3R)-3-hydroxybutyl]phenol. InChIKey: SFUCGABQOMYVJW-MRVPVSSYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 4-[(3R)-3-hydroxybutyl]phenol |
| InChIKey | SFUCGABQOMYVJW-MRVPVSSYSA-N |
| SMILES | C[C@H](CCC1=CC=C(C=C1)O)O |
Computed by PubChem (NCBI)