(R)-4-(tert-Butyl)-2-(4-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee
cas: 2828432-07-9 — see every product listed under this CAS number, including other names
(R)-4-(tert-Butyl)-2-(4-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee (CAS 2828432-07-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1220182-250mg |
| cas | 2828432-07-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 759.75 Pln | |
| Ambeed | 1g | 2028.00 Pln | |
| Ambeed | 5g | 8775.31 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 814.18 Pln | |
| BLDpharm | 1g | 2180.37 Pln | |
| BLDpharm | 5g | 9455.58 Pln | |
| Chemat | 100mg | 419.60 Pln | |
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 1g | 2195.60 Pln |
properties
| purity | 97% 99%ee |
|---|---|
| delivery time | 1-2 weeks |
(4R)-4-tert-butyl-2-[4-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole (CAS 2828432-07-9) is a chemical compound with the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. IUPAC name: (4R)-4-tert-butyl-2-[4-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole. InChIKey: ALYKOKFCPJUMPB-JTQLQIEISA-N.
| Molecular formula | C13H15F3N2O |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | (4R)-4-tert-butyl-2-[4-(trifluoromethyl)-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
| InChIKey | ALYKOKFCPJUMPB-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@@H]1COC(=N1)C2=NC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
(R)-4-(tert-Butyl)-2-(4-(trifluoromethyl)pyridin-2-yl)-4,5-dihydrooxazole, (4R)-4-tert-butyl-2-[4-(trifluoromethyl)-2-pyridyl]-4,5-dihydrooxazole, (R)-4-(tert-Butyl)-2-[4-(trifluoromethyl)-2-pyridyl]-4,5-dihydrooxazole, (4R)-4-tert-butyl-2-[4-(trifluoromethyl)pyridin-2-yl]-4,5-dihydro-1,3-oxazole, 2-[(4R)-4-tert-Butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)pyridine