CAS 1016515-38-0 is the registry number for (1,4-Diazepan-1-yl)(3-(trifluoromethyl)phenyl)methanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-diazepan-1-yl-[3-(trifluoromethyl)phenyl]methanone (CAS 1016515-38-0) is a chemical compound with the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. IUPAC name: 1,4-diazepan-1-yl-[3-(trifluoromethyl)phenyl]methanone. InChIKey: STJNUBDPLBXZNE-UHFFFAOYSA-N.
| Molecular formula | C13H15F3N2O |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | 1,4-diazepan-1-yl-[3-(trifluoromethyl)phenyl]methanone |
| InChIKey | STJNUBDPLBXZNE-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)