CAS 1456116-50-9 is the registry number for (4-Amino-3-trifluoromethyl-phenyl)-piperidin-1-yl-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-amino-3-(trifluoromethyl)phenyl]-piperidin-1-ylmethanone (CAS 1456116-50-9) is a chemical compound with the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. IUPAC name: [4-amino-3-(trifluoromethyl)phenyl]-piperidin-1-ylmethanone. InChIKey: NDABCRANBROHQR-UHFFFAOYSA-N.
| Molecular formula | C13H15F3N2O |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | [4-amino-3-(trifluoromethyl)phenyl]-piperidin-1-ylmethanone |
| InChIKey | NDABCRANBROHQR-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CC(=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)