cas: 1217848-48-0 — see every product listed under this CAS number, including other names
(R)-Benzyl 2-methylpiperazine-1-carboxylate hydrochloride 95% (CAS 1217848-48-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A359168-250mg |
| cas | 1217848-48-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 259.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A359168 |
Benzyl (2R)-2-methylpiperazine-1-carboxylate;hydrochloride (CAS 1217848-48-0) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (2R)-2-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: WQPQNIUAWYRGJF-RFVHGSKJSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (2R)-2-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | WQPQNIUAWYRGJF-RFVHGSKJSA-N |
| SMILES | C[C@@H]1CNCCN1C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)