cas: 1217781-62-8 — see every product listed under this CAS number, including other names
(R)-Benzyl 3-aminopiperidine-1-carboxylate hydrochloride, 95%, 95% (CAS 1217781-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126Y6-100mg |
| cas | 1217781-62-8 |
| size | 100mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 477.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl (3R)-3-aminopiperidine-1-carboxylate;hydrochloride (CAS 1217781-62-8) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (3R)-3-aminopiperidine-1-carboxylate;hydrochloride. InChIKey: ODSBVOIXQVBLEU-UTONKHPSSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (3R)-3-aminopiperidine-1-carboxylate;hydrochloride |
| InChIKey | ODSBVOIXQVBLEU-UTONKHPSSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)