cas: 100858-34-2 — see every product listed under this CAS number, including other names
(R)-Benzyl 3-hydroxypiperidine-1-carboxylate, 95% (CAS 100858-34-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321550-1G |
| cas | 100858-34-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 258.26 Pln | |
| Fluorochem | 100g | 612.30 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl (3R)-3-hydroxypiperidine-1-carboxylate (CAS 100858-34-2) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: benzyl (3R)-3-hydroxypiperidine-1-carboxylate. InChIKey: NDGWBAFATMSBHZ-GFCCVEGCSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | benzyl (3R)-3-hydroxypiperidine-1-carboxylate |
| InChIKey | NDGWBAFATMSBHZ-GFCCVEGCSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)