CAS 72597-18-3 appears in our catalog under these names: Cbz-D-prolinol, 96%, (R)–Benzyl 2–(hydroxymethyl)pyrrolidine–1–carboxylate, Z-D-Prolinol 96%, Cbz-D-Prolinol, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100g, 25g, 10g.
Benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 72597-18-3) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: BJTNHGVCFWDNDP-GFCCVEGCSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | BJTNHGVCFWDNDP-GFCCVEGCSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)