CAS 1245563-21-6 is the registry number for 2-tert-Butyl-3-hydroxy-4-methoxyisoindolin-1-one, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2-tert-butyl-3-hydroxy-4-methoxy-3H-isoindol-1-one (CAS 1245563-21-6) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 2-tert-butyl-3-hydroxy-4-methoxy-3H-isoindol-1-one. InChIKey: HMCZLBSINNXAJN-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 2-tert-butyl-3-hydroxy-4-methoxy-3H-isoindol-1-one |
| InChIKey | HMCZLBSINNXAJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(C2=C(C1=O)C=CC=C2OC)O |
Computed by PubChem (NCBI)