cas: 130539-03-6 — see every product listed under this CAS number, including other names
(R)-Benzyl 4-amino-2-((tert-butoxycarbonyl)amino)-4-oxobutanoate 95% (CAS 130539-03-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1125615-1g |
| cas | 130539-03-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 565.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1125615 |
Benzyl (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 130539-03-6) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: benzyl (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: VNFPRPGXGYMAKL-GFCCVEGCSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | benzyl (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | VNFPRPGXGYMAKL-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)N)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)