CAS 13254-04-1 is the registry number for Z-Ile-gly-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetic acid (CAS 13254-04-1) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: 2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetic acid. InChIKey: RWAYODJQGJVQGX-FZMZJTMJSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | 2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetic acid |
| InChIKey | RWAYODJQGJVQGX-FZMZJTMJSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)