cas: 95729-87-6 — see every product listed under this CAS number, including other names
(R)-Benzyl 4-oxoazetidine-2-carboxylate, 98%, 98% (CAS 95729-87-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJEV-100mg |
| cas | 95729-87-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1734.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2R)-4-oxoazetidine-2-carboxylate (CAS 95729-87-6) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: benzyl (2R)-4-oxoazetidine-2-carboxylate. InChIKey: WGLLBHSIXLWVFU-SECBINFHSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | benzyl (2R)-4-oxoazetidine-2-carboxylate |
| InChIKey | WGLLBHSIXLWVFU-SECBINFHSA-N |
| SMILES | C1[C@@H](NC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)