CAS 1355248-05-3 appears in our catalog under these names: 1-(4-Formylphenyl)azetidine-3-carboxylic acid, 1-(4-Formylphenyl)azetidine-3-carboxylic acid, 98%, 1-(4-Formylphenyl)azetidine-3-carboxylic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 10g, 5g, 100mg, 250mg.
1-(4-formylphenyl)azetidine-3-carboxylic acid (CAS 1355248-05-3) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 1-(4-formylphenyl)azetidine-3-carboxylic acid. InChIKey: JBVARJKZZNPSDV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-(4-formylphenyl)azetidine-3-carboxylic acid |
| InChIKey | JBVARJKZZNPSDV-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=CC=C(C=C2)C=O)C(=O)O |
Computed by PubChem (NCBI)