cas: 83540-97-0 — see every product listed under this CAS number, including other names
(R)-Diisopropyl 2-hydroxysuccinate, 98% (CAS 83540-97-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A139534-1g |
| cas | 83540-97-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 200.20 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 10g | 351.98 Pln | |
| Fluorochem | 25g | 674.78 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Dipropan-2-yl (2R)-2-hydroxybutanedioate (CAS 83540-97-0) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: dipropan-2-yl (2R)-2-hydroxybutanedioate. InChIKey: XYVHRFVONMVDGK-MRVPVSSYSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | dipropan-2-yl (2R)-2-hydroxybutanedioate |
| InChIKey | XYVHRFVONMVDGK-MRVPVSSYSA-N |
| SMILES | CC(C)OC(=O)C[C@H](C(=O)OC(C)C)O |
Computed by PubChem (NCBI)