cas: 83540-97-0 — see every product listed under this CAS number, including other names
Diisopropyl (R)-(+)-malate, 98%, 98% (CAS 83540-97-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119J56-1g |
| cas | 83540-97-0 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 10g | 218.00 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 100g | 1317.20 Pln | |
| Chemat | 500g | 4516.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dipropan-2-yl (2R)-2-hydroxybutanedioate (CAS 83540-97-0) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: dipropan-2-yl (2R)-2-hydroxybutanedioate. InChIKey: XYVHRFVONMVDGK-MRVPVSSYSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | dipropan-2-yl (2R)-2-hydroxybutanedioate |
| InChIKey | XYVHRFVONMVDGK-MRVPVSSYSA-N |
| SMILES | CC(C)OC(=O)C[C@H](C(=O)OC(C)C)O |
Computed by PubChem (NCBI)