cas: 130812-44-1 — see every product listed under this CAS number, including other names
(R)-Methyl 2-(((benzyloxy)carbonyl)amino)-3-(1H-indol-3-yl)propanoate, 95%, 95% (CAS 130812-44-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HS0E-100mg |
| cas | 130812-44-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 635.60 Pln | |
| Chemat | 5g | 2358.80 Pln | |
| Chemat | 10g | 4317.20 Pln | |
| Chemat | 25g | 7624.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 130812-44-1) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: methyl (2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: DYWXSVJXETXGGQ-GOSISDBHSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | methyl (2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | DYWXSVJXETXGGQ-GOSISDBHSA-N |
| SMILES | COC(=O)[C@@H](CC1=CNC2=CC=CC=C21)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)