Products 1509958-19-3
CAS 1509958-19-3 appears in our catalog under these names: Roxadustat Impurity 35, Roxadustat Impurity 23. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 1-[(dimethylamino)methyl]-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate (CAS 1509958-19-3) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: methyl 1-[(dimethylamino)methyl]-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate. InChIKey: ZIKSUKAGLAJTQJ-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | methyl 1-[(dimethylamino)methyl]-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate |
| InChIKey | ZIKSUKAGLAJTQJ-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=NC(=C(C2=C1C=C(C=C2)OC3=CC=CC=C3)O)C(=O)OC |
Computed by PubChem (NCBI)