cas: 1234880-33-1 — see every product listed under this CAS number, including other names
(R)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(5-hydroxy-1H-indol-3-yl)propanoate, 95%, 95% (CAS 1234880-33-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CBP-100mg |
| cas | 1234880-33-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 866.00 Pln | |
| Chemat | 250mg | 1432.40 Pln | |
| Chemat | 1g | 3760.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-3-(5-hydroxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1234880-33-1) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: methyl (2R)-3-(5-hydroxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: XNPXNIXOCSKSGI-CQSZACIVSA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | methyl (2R)-3-(5-hydroxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | XNPXNIXOCSKSGI-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CNC2=C1C=C(C=C2)O)C(=O)OC |
Computed by PubChem (NCBI)