CAS 161468-58-2 appears in our catalog under these names: 1,3-Di-tert-butyl 2-oxo-1,3-benzodiazole-1,3-dicarboxylate, 96%, Di-tert-butyl 2-oxo-1H-benzo(d)imidazole-1,3(2H)-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
Ditert-butyl 2-oxobenzimidazole-1,3-dicarboxylate (CAS 161468-58-2) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: ditert-butyl 2-oxobenzimidazole-1,3-dicarboxylate. InChIKey: DYOHDQGZQJYKIR-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | ditert-butyl 2-oxobenzimidazole-1,3-dicarboxylate |
| InChIKey | DYOHDQGZQJYKIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2N(C1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)