CAS 203736-17-8 appears in our catalog under these names: (S)-Methyl 2-((tert-butoxycarbonyl)amino)-3-(5-hydroxy-1H-indol-3-yl)propanoate, 97%, N-Boc-5-hydroxytryptophan Methyl Ester, N-Boc-5-hydroxytryptophan Methyl Ester, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 5g, 1g.
Methyl (2S)-3-(5-hydroxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 203736-17-8) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: methyl (2S)-3-(5-hydroxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: XNPXNIXOCSKSGI-AWEZNQCLSA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | methyl (2S)-3-(5-hydroxy-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | XNPXNIXOCSKSGI-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CNC2=C1C=C(C=C2)O)C(=O)OC |
Computed by PubChem (NCBI)