cas: 93267-04-0 — see every product listed under this CAS number, including other names
(R)-Methyl 2-(tert-butoxycarbonylamino)-3-iodopropanoate, 98% (CAS 93267-04-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11464X-1g |
| cas | 93267-04-0 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 50g | 227.60 Pln | |
| Chemat | 100g | 357.20 Pln | |
| Chemat | 250g | 794.00 Pln | |
| Chemat | 500g | 1579.20 Pln | |
| Chemat | 1kg | 2766.80 Pln | |
| Chemat | 5kg | 12278.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 93267-04-0) is a chemical compound with the molecular formula C9H16INO4 and a molecular weight of 329.13 g/mol. IUPAC name: methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: UGZBFCCHLUWCQI-LURJTMIESA-N.
| Molecular formula | C9H16INO4 |
|---|---|
| Molecular weight | 329.13 g/mol |
| IUPAC name | methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | UGZBFCCHLUWCQI-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CI)C(=O)OC |
Computed by PubChem (NCBI)