cas: 93267-04-0 — see every product listed under this CAS number, including other names
Boc-β-iodo-Ala-OMe 98% (CAS 93267-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A187373-250mg |
| cas | 93267-04-0 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 487.19 Pln | |
| Ambeed | 500g | 1955.69 Pln | |
| Ambeed | 1000g | 3813.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A187373 |
Methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 93267-04-0) is a chemical compound with the molecular formula C9H16INO4 and a molecular weight of 329.13 g/mol. IUPAC name: methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: UGZBFCCHLUWCQI-LURJTMIESA-N.
| Molecular formula | C9H16INO4 |
|---|---|
| Molecular weight | 329.13 g/mol |
| IUPAC name | methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | UGZBFCCHLUWCQI-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CI)C(=O)OC |
Computed by PubChem (NCBI)