cas: 93267-04-0 — see every product listed under this CAS number, including other names
Boc-ß-iodo-Ala-OMe, 95% (CAS 93267-04-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03256-1G |
| cas | 93267-04-0 |
| size | 1g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 117.68 Pln | |
| Fluorochem | 25g | 200.99 Pln | |
| Fluorochem | 50g | 331.15 Pln | |
| Fluorochem | 100g | 497.76 Pln | |
| Fluorochem | 500g | 1981.61 Pln | |
| Fluorochem | 1kg | 3829.92 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
Methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 93267-04-0) is a chemical compound with the molecular formula C9H16INO4 and a molecular weight of 329.13 g/mol. IUPAC name: methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: UGZBFCCHLUWCQI-LURJTMIESA-N.
| Molecular formula | C9H16INO4 |
|---|---|
| Molecular weight | 329.13 g/mol |
| IUPAC name | methyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | UGZBFCCHLUWCQI-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CI)C(=O)OC |
Computed by PubChem (NCBI)