cas: 637027-25-9 — see every product listed under this CAS number, including other names
(R)-Methyl piperazine-2-carboxylate dihydrochloride 98% (CAS 637027-25-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A488565-250mg |
| cas | 637027-25-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 659.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A488565 |
Methyl (2R)-piperazine-2-carboxylate;dihydrochloride (CAS 637027-25-9) is a chemical compound with the molecular formula C6H14Cl2N2O2 and a molecular weight of 217.09 g/mol. IUPAC name: methyl (2R)-piperazine-2-carboxylate;dihydrochloride. InChIKey: ZBYFDUSYNDLSND-ZJIMSODOSA-N.
| Molecular formula | C6H14Cl2N2O2 |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | methyl (2R)-piperazine-2-carboxylate;dihydrochloride |
| InChIKey | ZBYFDUSYNDLSND-ZJIMSODOSA-N |
| SMILES | COC(=O)[C@H]1CNCCN1.Cl.Cl |
Computed by PubChem (NCBI)