cas: 913642-85-0 — see every product listed under this CAS number, including other names
(R)-N-Boc-2-Morpholinecarbaldehyde 92% (CAS 913642-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A353366-100mg |
| cas | 913642-85-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 687.44 Pln | |
| Ambeed | 250mg | 993.38 Pln | |
| Ambeed | 1g | 2534.19 Pln | |
| Ambeed | 5g | 7618.31 Pln |
| purity | 92% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A353366 |
Tert-butyl (2R)-2-formylmorpholine-4-carboxylate (CAS 913642-85-0) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: tert-butyl (2R)-2-formylmorpholine-4-carboxylate. InChIKey: LWKMTSRRGUVABD-MRVPVSSYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | tert-butyl (2R)-2-formylmorpholine-4-carboxylate |
| InChIKey | LWKMTSRRGUVABD-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](C1)C=O |
Computed by PubChem (NCBI)