cas: 913642-85-0 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-formylmorpholine-4-carboxylate, 92% (CAS 913642-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F604137-100MG |
| cas | 913642-85-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 857.01 Pln | |
| Fluorochem | 250mg | 1247.50 Pln | |
| Fluorochem | 1g | 3199.93 Pln | |
| Fluorochem | 5g | 9666.41 Pln |
| purity | 92% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2R)-2-formylmorpholine-4-carboxylate (CAS 913642-85-0) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: tert-butyl (2R)-2-formylmorpholine-4-carboxylate. InChIKey: LWKMTSRRGUVABD-MRVPVSSYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | tert-butyl (2R)-2-formylmorpholine-4-carboxylate |
| InChIKey | LWKMTSRRGUVABD-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](C1)C=O |
Computed by PubChem (NCBI)