cas: 1187932-25-7 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (1-(3-bromophenyl)ethyl)carbamate 97% (CAS 1187932-25-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A350430-100mg |
| cas | 1187932-25-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1482.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A350430 |
Tert-butyl N-[(1R)-1-(3-bromophenyl)ethyl]carbamate (CAS 1187932-25-7) is a chemical compound with the molecular formula C13H18BrNO2 and a molecular weight of 300.19 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(3-bromophenyl)ethyl]carbamate. InChIKey: WWNQMGYJYMXOEU-SECBINFHSA-N.
| Molecular formula | C13H18BrNO2 |
|---|---|
| Molecular weight | 300.19 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(3-bromophenyl)ethyl]carbamate |
| InChIKey | WWNQMGYJYMXOEU-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)