CAS 1261988-52-6 is the registry number for N-t-Butyl 4-bromo-2-ethoxybenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
4-bromo-N-tert-butyl-2-ethoxybenzamide (CAS 1261988-52-6) is a chemical compound with the molecular formula C13H18BrNO2 and a molecular weight of 300.19 g/mol. IUPAC name: 4-bromo-N-tert-butyl-2-ethoxybenzamide. InChIKey: HEHSYLPUUOXERL-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2 |
|---|---|
| Molecular weight | 300.19 g/mol |
| IUPAC name | 4-bromo-N-tert-butyl-2-ethoxybenzamide |
| InChIKey | HEHSYLPUUOXERL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)Br)C(=O)NC(C)(C)C |
Computed by PubChem (NCBI)