CAS 877064-95-4 is the registry number for (3-Bromo-4-methyl-phenyl)-methyl-carbamic acid tert-butyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Tert-butyl N-(3-bromo-4-methylphenyl)-N-methylcarbamate (CAS 877064-95-4) is a chemical compound with the molecular formula C13H18BrNO2 and a molecular weight of 300.19 g/mol. IUPAC name: tert-butyl N-(3-bromo-4-methylphenyl)-N-methylcarbamate. InChIKey: RQGCJQIAGDDTKJ-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2 |
|---|---|
| Molecular weight | 300.19 g/mol |
| IUPAC name | tert-butyl N-(3-bromo-4-methylphenyl)-N-methylcarbamate |
| InChIKey | RQGCJQIAGDDTKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N(C)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)