cas: 926291-64-7 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (1-(3-chlorophenyl)-2-hydroxyethyl)carbamate 97% (CAS 926291-64-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A165468-250mg |
| cas | 926291-64-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1032.31 Pln | |
| Ambeed | 5g | 2984.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A165468 |
Tert-butyl N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate (CAS 926291-64-7) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate. InChIKey: SWYMATJMMKRYJJ-NSHDSACASA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
| InChIKey | SWYMATJMMKRYJJ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)