cas: 926291-64-7 — see every product listed under this CAS number, including other names
(R)-tert-Butyl (1-(3-chlorophenyl)-2-hydroxyethyl)carbamate, 97%, 97% (CAS 926291-64-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMP2-250mg |
| cas | 926291-64-7 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1523.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate (CAS 926291-64-7) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate. InChIKey: SWYMATJMMKRYJJ-NSHDSACASA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
| InChIKey | SWYMATJMMKRYJJ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)