cas: 1363378-13-5 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-(bromomethyl)azetidine-1-carboxylate, 97% (CAS 1363378-13-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 500mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A404608-10g |
| cas | 1363378-13-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10791.97 Pln | |
| AmBeed | 25g | 20765.29 Pln | |
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 500mg | 1299.56 Pln | |
| Fluorochem | 1g | 2226.32 Pln | |
| Fluorochem | 5g | 6224.91 Pln | |
| Fluorochem | 10g | 10837.87 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (2R)-2-(bromomethyl)azetidine-1-carboxylate (CAS 1363378-13-5) is a chemical compound with the molecular formula C9H16BrNO2 and a molecular weight of 250.13 g/mol. IUPAC name: tert-butyl (2R)-2-(bromomethyl)azetidine-1-carboxylate. InChIKey: YDUBHKXBYBMWRH-SSDOTTSWSA-N.
| Molecular formula | C9H16BrNO2 |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | tert-butyl (2R)-2-(bromomethyl)azetidine-1-carboxylate |
| InChIKey | YDUBHKXBYBMWRH-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]1CBr |
Computed by PubChem (NCBI)