cas: 65715-93-7 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-amino-2-phenylacetate, 95% (CAS 65715-93-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210643-1G |
| cas | 65715-93-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 216.61 Pln | |
| Fluorochem | 25g | 357.18 Pln | |
| Fluorochem | 100g | 1101.71 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2R)-2-amino-2-phenylacetate (CAS 65715-93-7) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl (2R)-2-amino-2-phenylacetate. InChIKey: HJLYKRGXTOVWFL-SNVBAGLBSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-2-phenylacetate |
| InChIKey | HJLYKRGXTOVWFL-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)