cas: 876617-06-0 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-ethylpyrrolidine-1-carboxylate 97% (CAS 876617-06-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217784-250mg |
| cas | 876617-06-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 987.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217784 |
Tert-butyl (2R)-2-ethylpyrrolidine-1-carboxylate (CAS 876617-06-0) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: tert-butyl (2R)-2-ethylpyrrolidine-1-carboxylate. InChIKey: JWPIUFHZDRAHKC-SECBINFHSA-N.
| Molecular formula | C11H21NO2 |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | tert-butyl (2R)-2-ethylpyrrolidine-1-carboxylate |
| InChIKey | JWPIUFHZDRAHKC-SECBINFHSA-N |
| SMILES | CC[C@@H]1CCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)