cas: 876617-06-0 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 2-ethylpyrrolidine-1-carboxylate, 97%, 97% (CAS 876617-06-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CC4-250mg |
| cas | 876617-06-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 837.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R)-2-ethylpyrrolidine-1-carboxylate (CAS 876617-06-0) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: tert-butyl (2R)-2-ethylpyrrolidine-1-carboxylate. InChIKey: JWPIUFHZDRAHKC-SECBINFHSA-N.
| Molecular formula | C11H21NO2 |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | tert-butyl (2R)-2-ethylpyrrolidine-1-carboxylate |
| InChIKey | JWPIUFHZDRAHKC-SECBINFHSA-N |
| SMILES | CC[C@@H]1CCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)