cas: 1313705-92-8 — see every product listed under this CAS number, including other names
(R)-tert-Butyl 4-(tert-butyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 97%, 97% (CAS 1313705-92-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110F73-50mg |
| cas | 1313705-92-8 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 131.60 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 746.00 Pln | |
| Chemat | 10g | 1072.40 Pln | |
| Chemat | 25g | 2171.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4R)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1313705-92-8) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl (4R)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: HSGFAURARADKGN-QMMMGPOBSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl (4R)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | HSGFAURARADKGN-QMMMGPOBSA-N |
| SMILES | CC(C)(C)[C@@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)