CAS 1313705-92-8 appears in our catalog under these names: (4R)-4-T-Butyl-1,2,3-oxathiazolidine-2,2-dioxide-3-carboxylic acid t-butyl ester, 95%, (4R)​-4-​(1,​1-​Dimethylethyl)​-1,​2,​3-​oxathiazolidine-​3-​carboxylic acid 1,​1-​dimethylethyl ester 2,​2-​dioxide, (R)-tert-Butyl 4-(tert-butyl)-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 97%, 97%, (4R)-4-T-BUTYL-1,2,3-OXATHIAZOLIDINE-2,2-DIOXIDE-3-CARBOXYLIC ACID T-BUTYL ESTER, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 2,5g, 50mg, 100mg, 10g, 25g.
Tert-butyl (4R)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 1313705-92-8) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl (4R)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: HSGFAURARADKGN-QMMMGPOBSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl (4R)-4-tert-butyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | HSGFAURARADKGN-QMMMGPOBSA-N |
| SMILES | CC(C)(C)[C@@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)