CAS 63701-09-7 appears in our catalog under these names: methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-4-methanesulfinylbutanoate, 95%, Methyl (2S)-2-{((tert-butoxy)carbonyl)amino}-4-methanesulfinylbutanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoate (CAS 63701-09-7) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoate. InChIKey: VKIABJUARDZNRU-RFXRWSEHSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfinylbutanoate |
| InChIKey | VKIABJUARDZNRU-RFXRWSEHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCS(=O)C)C(=O)OC |
Computed by PubChem (NCBI)