cas: 1447823-06-4 — see every product listed under this CAS number, including other names
(R)-tert-Butyl azepan-4-ylcarbamate, 97% (CAS 1447823-06-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A106552-5g |
| cas | 1447823-06-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 21090.79 Pln | |
| Fluorochem | 100mg | 1872.28 Pln | |
| Fluorochem | 250mg | 2950.02 Pln | |
| Fluorochem | 1g | 7250.59 Pln | |
| Fluorochem | 500mg | 4855.60 Pln | |
| Fluorochem | 5g | 21604.91 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[(4R)-azepan-4-yl]carbamate (CAS 1447823-06-4) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(4R)-azepan-4-yl]carbamate. InChIKey: MIYUNZAWHSSBPU-SECBINFHSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(4R)-azepan-4-yl]carbamate |
| InChIKey | MIYUNZAWHSSBPU-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCNCC1 |
Computed by PubChem (NCBI)