cas: 1447823-06-4 — see every product listed under this CAS number, including other names
tert-butyl N-[(4R)-azepan-4-yl]carbamate, 95%, 95% (CAS 1447823-06-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ATGV-100mg |
| cas | 1447823-06-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 942.80 Pln | |
| Chemat | 250mg | 1480.40 Pln | |
| Chemat | 1g | 3486.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(4R)-azepan-4-yl]carbamate (CAS 1447823-06-4) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(4R)-azepan-4-yl]carbamate. InChIKey: MIYUNZAWHSSBPU-SECBINFHSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(4R)-azepan-4-yl]carbamate |
| InChIKey | MIYUNZAWHSSBPU-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCNCC1 |
Computed by PubChem (NCBI)