cas: 127604-16-4 — see every product listed under this CAS number, including other names
(S)-(+)-3-Hydroxybutyric acid sodium salt, 98%, 98% (CAS 127604-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111X8H-100mg |
| cas | 127604-16-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 582.80 Pln | |
| Chemat | 10g | 1062.80 Pln | |
| Chemat | 25g | 2474.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sodium (3S)-3-hydroxybutanoate (CAS 127604-16-4) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 126.09 g/mol. IUPAC name: sodium (3S)-3-hydroxybutanoate. InChIKey: NBPUSGBJDWCHKC-DFWYDOINSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 126.09 g/mol |
| IUPAC name | sodium (3S)-3-hydroxybutanoate |
| InChIKey | NBPUSGBJDWCHKC-DFWYDOINSA-M |
| SMILES | C[C@@H](CC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)